Difference between revisions of "Tiso gene 6497"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=...")
(Created page with "Category:Gene == Gene Tiso_gene_6497 == * right end position: ** 11188 * transcription direction: ** POSITIVE * left end position: ** 5775 * centisome position: ** 47.6288...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] ==
+
== Gene Tiso_gene_6497 ==
−
* smiles:
+
* right end position:
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
+
** 11188
−
* common name:
+
* transcription direction:
−
** N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
+
** 5775
−
* molecular weight:
+
* centisome position:
−
** 492.298    
+
** 47.628864    
 
* Synonym(s):
 
* Synonym(s):
−
** iPDP
 
−
** isopentenyladenosine riboside-5'-diphosphate
 
−
** iPRDP
 
−
** isopentenyladenosine-5'-diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.1.21-RXN]]
−
* [[RXN-4305]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[GLUCOSYLCERAMIDASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10769]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10773]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13600]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13602]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13603]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14179]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-5341]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-8036]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9674]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-3121]]
 +
* [[PWY-6002]]
 +
* [[PWY-6788]]
 +
* [[PWY-5176]]
 +
* [[PWY-7092]]
 +
* [[PWY-7091]]
 +
* [[PWY-7089]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=11188}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202829 25202829]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=5775}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73533 73533]
+
{{#set: centisome position=47.628864   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.2.1.21-RXN|GLUCOSYLCERAMIDASE-RXN|RXN-10769|RXN-10773|RXN-13600|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16426 C16426]
+
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091|PWY-7089}}
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C}}
+
−
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate}}
+
−
{{#set: inchi key=InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K}}
+
−
{{#set: molecular weight=492.298   }}
+
−
{{#set: common name=iPDP|isopentenyladenosine riboside-5'-diphosphate|iPRDP|isopentenyladenosine-5'-diphosphate}}
+
−
{{#set: produced by=RXN-4305}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_6497

  • right end position:
    • 11188
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5775
  • centisome position:
    • 47.628864
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6497&oldid=45799"