Difference between revisions of "FADH2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * common name: ** monodehydroa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * smiles: ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == |
* smiles: | * smiles: | ||
| − | ** C(O)C(O)[ | + | ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O)) |
* common name: | * common name: | ||
| − | ** | + | ** FADH2 |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 785.556 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** flavin adenine dinucleotide reduced |
| − | ** | + | ** 1,5-dihydro-FAD |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[G3PD3]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[MEPROPCOA-FAD-RXN]] |
| − | * [[ | + | * [[ACOA120or]] |
| + | * [[MCDH_2mb2coa]] | ||
| + | * [[ACOA140or]] | ||
| + | * [[ACOA160or]] | ||
| + | * [[ACOA80or]] | ||
| + | * [[MCDH]] | ||
| + | * [[IVCDH]] | ||
| + | * [[ACOA40or]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[PPCOAOm]] | ||
| + | * [[RXN-14264]] | ||
| + | * [[RXN-14193]] | ||
== External links == | == External links == | ||
| + | * CAS : 1910-41-4 | ||
| + | * BIGG : fadh2 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931118 46931118] |
| − | * | + | * HMDB : HMDB01197 |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01352 C01352] |
| − | {{#set: smiles=C(O)C(O)[ | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58307 58307] |
| − | {{#set: inchi key=InChIKey= | + | * METABOLIGHTS : MTBLC58307 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))}} |
| − | {{#set: common name= | + | {{#set: common name=FADH2}} |
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L}} |
| − | {{#set: | + | {{#set: molecular weight=785.556 }} |
| + | {{#set: common name=flavin adenine dinucleotide reduced|1,5-dihydro-FAD}} | ||
| + | {{#set: consumed by=G3PD3}} | ||
| + | {{#set: produced by=MEPROPCOA-FAD-RXN|ACOA120or|MCDH_2mb2coa|ACOA140or|ACOA160or|ACOA80or|MCDH|IVCDH|ACOA40or}} | ||
| + | {{#set: reversible reaction associated=PPCOAOm|RXN-14264|RXN-14193}} | ||
Latest revision as of 21:05, 21 March 2018
Contents
Metabolite FADH2
- smiles:
- CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))
- common name:
- FADH2
- inchi key:
- InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L
- molecular weight:
- 785.556
- Synonym(s):
- flavin adenine dinucleotide reduced
- 1,5-dihydro-FAD
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1910-41-4
- BIGG : fadh2
- PUBCHEM:
- HMDB : HMDB01197
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58307
"CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))" cannot be used as a page name in this wiki.
