Difference between revisions of "CPD-226"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16788 RXN-16788] == * direction: ** REVERSIBLE * common name: ** plastid_phosphoglycerate_mutas...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == * smiles: ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16788 RXN-16788] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
 
* common name:
 
* common name:
** plastid_phosphoglycerate_mutase_protein
+
** vinylacetyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.1.3.73 EC-3.1.3.73]
+
** InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J
 +
* molecular weight:
 +
** 831.577   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-butenoyl-CoA
 +
** but-3-enoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[ALPHA-RIBAZOLE-5-P]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[ALPHA-RIBAZOLE]][c] '''+''' 1 [[Pi]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[VINYLACETYL-COA-DELTA-ISOMERASE-RXN]]
** 1 &alpha;-ribazole 5'-phosphate[c] '''+''' 1 H2O[c] '''<=>''' 1 &alpha;-ribazole[c] '''+''' 1 phosphate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Tiso_gene_16271]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
{{#set: common name=plastid_phosphoglycerate_mutase_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266616 45266616]
{{#set: ec number=EC-3.1.3.73}}
+
* CHEBI:
{{#set: gene associated=Tiso_gene_16271}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57396 57396]
{{#set: in pathway=}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02331 C02331]
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: smiles=C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=vinylacetyl-CoA}}
 +
{{#set: inchi key=InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J}}
 +
{{#set: molecular weight=831.577    }}
 +
{{#set: common name=3-butenoyl-CoA|but-3-enoyl-CoA}}
 +
{{#set: reversible reaction associated=VINYLACETYL-COA-DELTA-ISOMERASE-RXN}}

Latest revision as of 21:06, 21 March 2018

Metabolite CPD-226

  • smiles:
    • C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • common name:
    • vinylacetyl-CoA
  • inchi key:
    • InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J
  • molecular weight:
    • 831.577
  • Synonym(s):
    • 3-butenoyl-CoA
    • but-3-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.