Difference between revisions of "CPD-4127"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9952 RXN-9952] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyisobutyrate_mitochon...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9952 RXN-9952] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** 3-hydroxyisobutyrate_mitochondrial
+
** isofucosterol
−
** 6-phosphogluconate_decarboxylating
+
* inchi key:
−
** ORF
+
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.44 EC-1.1.1.44]
+
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADP]][c] '''+''' 1 [[CPD-2961]][c] '''=>''' 1 [[NADPH]][c] '''+''' 1 [[RIBULOSE-5P]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[RXN-4210]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADP+[c] '''+''' 1 D-gluconate 6-phosphate[c] '''=>''' 1 NADPH[c] '''+''' 1 D-ribulose 5-phosphate[c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_7157]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_19590]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_91]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_777]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_20238]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[OXIDATIVEPENT-PWY]], pentose phosphate pathway (oxidative branch) I: [http://metacyc.org/META/NEW-IMAGE?object=OXIDATIVEPENT-PWY OXIDATIVEPENT-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10116 10116]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326]
−
* LIGAND-RXN:
+
* HMDB : HMDB02374
−
** [http://www.genome.jp/dbget-bin/www_bget?R01528 R01528]
+
* LIGAND-CPD:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
−
{{#set: common name=3-hydroxyisobutyrate_mitochondrial}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: common name=6-phosphogluconate_decarboxylating}}
+
{{#set: common name=isofucosterol}}
−
{{#set: common name=ORF}}
+
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
−
{{#set: ec number=EC-1.1.1.44}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: gene associated=Tiso_gene_7157|Tiso_gene_19590|Tiso_gene_91|Tiso_gene_777|Tiso_gene_20238}}
+
{{#set: produced by=RXN-4210}}
−
{{#set: in pathway=OXIDATIVEPENT-PWY}}
+
−
{{#set: reconstruction category=orthology|manual|annotation}}
+
−
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 21:06, 21 March 2018

Metabolite CPD-4127

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • isofucosterol
  • inchi key:
    • InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4127&oldid=46028"