Difference between revisions of "D-mannopyranose"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] == * smiles: ** C(C(O)CC(=O)[O-])[N+](C)(C)C * common name: ** L-carnitine...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-mannopyranose D-mannopyranose] == * common name: ** D-mannopyranose * Synonym(s): ** carubino...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-mannopyranose D-mannopyranose] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** D-mannopyranose |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** carubinose |
− | ** | + | ** seminose |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[MANNKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13064]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14500]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=D-mannopyranose}} | |
− | + | {{#set: common name=carubinose|seminose}} | |
− | + | {{#set: consumed by=MANNKIN-RXN}} | |
− | + | {{#set: produced by=RXN-13064}} | |
− | + | {{#set: reversible reaction associated=RXN-14500}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 21:07, 21 March 2018
Contents
Metabolite D-mannopyranose
- common name:
- D-mannopyranose
- Synonym(s):
- carubinose
- seminose