Difference between revisions of "APS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta5-3-oxo-lignoceroyl-ACPs cis-delta5-3-oxo-lignoceroyl-ACPs] == * common name: ** a cis...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == |
| + | * smiles: | ||
| + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O | ||
* common name: | * common name: | ||
| − | ** | + | ** adenosine 5'-phosphosulfate |
| + | * inchi key: | ||
| + | ** InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L | ||
| + | * molecular weight: | ||
| + | ** 425.266 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** adenylyl-sulfate | ||
| + | ** APS | ||
| + | ** adenosine phosphosulfate | ||
| + | ** adenosine 5'-sulphatophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ADENYLYLSULFATASE-RXN]] |
| + | * [[AASP]] | ||
| + | * [[1.8.4.9-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[R163-RXN]] | ||
| + | * [[ADENYLYLSULFKIN-RXN]] | ||
| + | * [[SULFATE-ADENYLYLTRANS-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 485-84-7 |
| − | {{#set: consumed by= | + | * BIGG : aps |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852317 49852317] | ||
| + | * HMDB : HMDB01003 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00224 C00224] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58243 58243] | ||
| + | * METABOLIGHTS : MTBLC58243 | ||
| + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O}} | ||
| + | {{#set: common name=adenosine 5'-phosphosulfate}} | ||
| + | {{#set: inchi key=InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L}} | ||
| + | {{#set: molecular weight=425.266 }} | ||
| + | {{#set: common name=adenylyl-sulfate|APS|adenosine phosphosulfate|adenosine 5'-sulphatophosphate}} | ||
| + | {{#set: consumed by=ADENYLYLSULFATASE-RXN|AASP|1.8.4.9-RXN}} | ||
| + | {{#set: reversible reaction associated=R163-RXN|ADENYLYLSULFKIN-RXN|SULFATE-ADENYLYLTRANS-RXN}} | ||
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite APS
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O
- common name:
- adenosine 5'-phosphosulfate
- inchi key:
- InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L
- molecular weight:
- 425.266
- Synonym(s):
- adenylyl-sulfate
- APS
- adenosine phosphosulfate
- adenosine 5'-sulphatophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 485-84-7
- BIGG : aps
- PUBCHEM:
- HMDB : HMDB01003
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58243
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
