Difference between revisions of "Pre-tRNA-3-prime-half-molecules"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-BISPHOSPHATE INOSITOL-1-4-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-])[O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-3-prime-half-molecules Pre-tRNA-3-prime-half-molecules] == * common name: ** a 3'-half...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-BISPHOSPHATE INOSITOL-1-4-BISPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-3-prime-half-molecules Pre-tRNA-3-prime-half-molecules] ==
* smiles:
+
** C1(O)(C(O)C(OP(=O)([O-])[O-])C(O)C(O)C(OP([O-])([O-])=O)1)
+
 
* common name:
 
* common name:
** D-myo-inositol (1,4)-bisphosphate
+
** a 3'-half-tRNA molecule with a 5'-OH end
* inchi key:
+
** InChIKey=PELZSPZCXGTUMR-RTPHHQFDSA-J
+
* molecular weight:
+
** 336.085   
+
 
* Synonym(s):
 
* Synonym(s):
** Ins(1,4)P2
 
** myo-inositol (1,4)-bisphosphate
 
** inositol (1,4)-bisphosphate
 
** I(1,4)P2
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.57-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13334]]
+
* [[3.1.27.9-RXN]]
* [[3.1.3.56-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 47055-78-7
+
{{#set: common name=a 3'-half-tRNA molecule with a 5'-OH end}}
* PUBCHEM:
+
{{#set: produced by=3.1.27.9-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203530 25203530]
+
* HMDB : HMDB00968
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01220 C01220]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58282 58282]
+
* METABOLIGHTS : MTBLC58282
+
{{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(O)C(O)C(OP([O-])([O-])=O)1)}}
+
{{#set: common name=D-myo-inositol (1,4)-bisphosphate}}
+
{{#set: inchi key=InChIKey=PELZSPZCXGTUMR-RTPHHQFDSA-J}}
+
{{#set: molecular weight=336.085    }}
+
{{#set: common name=Ins(1,4)P2|myo-inositol (1,4)-bisphosphate|inositol (1,4)-bisphosphate|I(1,4)P2}}
+
{{#set: consumed by=3.1.3.57-RXN}}
+
{{#set: produced by=RXN-13334|3.1.3.56-RXN}}
+

Latest revision as of 20:08, 21 March 2018

Metabolite Pre-tRNA-3-prime-half-molecules

  • common name:
    • a 3'-half-tRNA molecule with a 5'-OH end
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links