Difference between revisions of "DNA-6-O-Methyl-Guanines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-6-O-Methyl-Guanines DNA-6-O-Methyl-Guanines] == * common name: ** an O6-methylguanine in DN...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-6-O-Methyl-Guanines DNA-6-O-Methyl-Guanines] ==
−
* smiles:
+
−
** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
 
* common name:
 
* common name:
−
** XLXG xyloglucan oligosaccharide
+
** an O6-methylguanine in DNA
−
* inchi key:
+
−
** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
+
−
* molecular weight:
+
−
** 1225.073   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a DNA 6-O-methylguanine
 +
** DNA 6-O-methylguanine
 +
** DNA (CONTAINING 6-O-METHYLGUANINE)
 +
** a DNA containing 6-O-methylguanine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12399]]
+
* [[2.1.1.63-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an O6-methylguanine in DNA}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192]
+
{{#set: common name=a DNA 6-O-methylguanine|DNA 6-O-methylguanine|DNA (CONTAINING 6-O-METHYLGUANINE)|a DNA containing 6-O-methylguanine}}
−
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: consumed by=2.1.1.63-RXN}}
−
{{#set: common name=XLXG xyloglucan oligosaccharide}}
+
−
{{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}}
+
−
{{#set: molecular weight=1225.073    }}
+
−
{{#set: consumed by=RXN-12399}}
+

Latest revision as of 21:08, 21 March 2018

Metabolite DNA-6-O-Methyl-Guanines

  • common name:
    • an O6-methylguanine in DNA
  • Synonym(s):
    • a DNA 6-O-methylguanine
    • DNA 6-O-methylguanine
    • DNA (CONTAINING 6-O-METHYLGUANINE)
    • a DNA containing 6-O-methylguanine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DNA-6-O-Methyl-Guanines&oldid=46234"