Difference between revisions of "2.3.1.179-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * common name: ** ca...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.179-RXN 2.3.1.179-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-car...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.179-RXN 2.3.1.179-RXN] ==
−
* smiles:
+
* direction:
−
** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** carboxyphosphinopyruvate
+
** 3-oxoacyl-(acyl-carrier-protein)_synthase
−
* inchi key:
+
** ORF
−
** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.3.1.179 EC-2.3.1.179]
−
** 193.029   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10828]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[Palmitoleoyl-ACPs]][c] '''=>''' 1 [[3-oxo-cis-vaccenoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c]
−
* [[RXN-10827]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 a palmitoleoyl-[acp][c] '''=>''' 1 a 3-oxo-cis-vacc-11-enoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_19303]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)_synthase}}
−
{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
+
{{#set: common name=ORF}}
−
{{#set: common name=carboxyphosphinopyruvate}}
+
{{#set: ec number=EC-2.3.1.179}}
−
{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
+
{{#set: gene associated=Tiso_gene_19302|Tiso_gene_14485|Tiso_gene_19303}}
−
{{#set: molecular weight=193.029    }}
+
{{#set: in pathway=PWY-5973}}
−
{{#set: consumed by=RXN-10828}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: produced by=RXN-10827}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:09, 21 March 2018

Reaction 2.3.1.179-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-(acyl-carrier-protein)_synthase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5973, cis-vaccenate biosynthesis: PWY-5973
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.3.1.179-RXN&oldid=46345"