Difference between revisions of "DIVINYL-PROTOCHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10165 == * right end position: ** 8281 * transcription direction: ** POSITIVE * left end position: ** 7216 * centisome position: ** 82.4026...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10165 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
−
* right end position:
+
* smiles:
−
** 8281
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 3,8-divinyl protochlorophyllide a
−
* left end position:
+
* molecular weight:
−
** 7216
+
** 608.935    
−
* centisome position:
+
−
** 82.40265    
+
 
* Synonym(s):
 
* Synonym(s):
 +
** divinylprotochlorophyllide
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
+
* [[RXN-5285]]
−
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Assignment: ec-number
+
* [[RXN-5284]]
−
* Reaction: [[RXN-12445]]
+
== Reaction(s) of unknown directionality ==
−
** Source: [[annotation-in-silico_annotation]]
+
* [[RXN-17487]]
−
*** Assignment: ec-number
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: right end position=8281}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
−
{{#set: left end position=7216}}
+
* CHEBI:
−
{{#set: centisome position=82.40265    }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
−
{{#set: reaction associated=NADPH-DEHYDROGENASE-FLAVIN-RXN|RXN-12445}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=3,8-divinyl protochlorophyllide a}}
 +
{{#set: molecular weight=608.935    }}
 +
{{#set: common name=divinylprotochlorophyllide}}
 +
{{#set: consumed by=RXN-5285}}
 +
{{#set: produced by=RXN-5284}}
 +
{{#set: reversible reaction associated=RXN-17487}}

Latest revision as of 21:09, 21 March 2018

Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • 3,8-divinyl protochlorophyllide a
  • molecular weight:
    • 608.935
  • Synonym(s):
    • divinylprotochlorophyllide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DIVINYL-PROTOCHLOROPHYLLIDE-A&oldid=46359"