Difference between revisions of "Tiso gene 17158"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * smiles: ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) * common name: ** L-phenylalanine * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_17158 == * right end position: ** 3425 * transcription direction: ** POSITIVE * left end position: ** 182 * centisome position: ** 4.694351...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17158 == |
− | * | + | * right end position: |
− | ** | + | ** 3425 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 182 |
− | * | + | * centisome position: |
− | ** | + | ** 4.694351 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.2.1.152-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: automated-name-match | |
− | == | + | == Pathways associated == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3425}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=182}} | |
− | + | {{#set: centisome position=4.694351 }} | |
− | + | {{#set: reaction associated=3.2.1.152-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:09, 21 March 2018
Gene Tiso_gene_17158
- right end position:
- 3425
- transcription direction:
- POSITIVE
- left end position:
- 182
- centisome position:
- 4.694351
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.152-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation