Difference between revisions of "ALPHA-GLC-6-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * smiles: ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * common...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) |
* common name: | * common name: | ||
| − | ** | + | ** α-D-glucose 6-phosphate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α-glucose 6-phosphate |
| − | + | ** α-D-glucose-6-P | |
| − | ** | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[UG6PGT]] | ||
| + | * [[UG6PGTn]] | ||
| + | * [[G6PADHh]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[BFFS]] |
| + | * [[RXN-1685]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[PGIA]] | ||
| + | * [[PGIAh]] | ||
| + | * [[G6PI]] | ||
| + | * [[G6PA_pi_th]] | ||
| + | * [[RXN-6182]] | ||
| + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | ||
| + | * [[PGMTh]] | ||
| + | * [[PGCM]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864] |
| − | * | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668] |
| − | {{#set: smiles= | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} |
| − | {{#set: common name= | + | {{#set: common name=α-D-glucose 6-phosphate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=258.121 }} |
| − | {{#set: common name= | + | {{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}} |
| − | {{#set: produced by=RXN- | + | {{#set: consumed by=UG6PGT|UG6PGTn|G6PADHh}} |
| + | {{#set: produced by=BFFS|RXN-1685}} | ||
| + | {{#set: reversible reaction associated=PGIA|PGIAh|G6PI|G6PA_pi_th|RXN-6182|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGMTh|PGCM}} | ||
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite ALPHA-GLC-6-P
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- common name:
- α-D-glucose 6-phosphate
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
- molecular weight:
- 258.121
- Synonym(s):
- α-glucose 6-phosphate
- α-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
