Difference between revisions of "CPD-10809"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.32-RXN 2.4.1.32-RXN] == * direction: ** REVERSIBLE * common name: ** family_2_glycosyl_transf...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.32-RXN 2.4.1.32-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
 
* common name:
 
* common name:
−
** family_2_glycosyl_transferase
+
** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.32 EC-2.4.1.32]
+
** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
 +
* molecular weight:
 +
** 353.228   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10058]]
−
** 1 [[Glucomannans]][c] '''+''' 1 [[GDP-MANNOSE]][c] '''<=>''' 1 [[GDP]][c] '''+''' 1 [[Glucomannans]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a glucomannan[c] '''+''' 1 GDP-&alpha;-D-mannose[c] '''<=>''' 1 GDP[c] '''+''' 1 a glucomannan[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_322]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03829 R03829]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553]
−
{{#set: direction=REVERSIBLE}}
+
* CHEBI:
−
{{#set: common name=family_2_glycosyl_transferase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890]
−
{{#set: ec number=EC-2.4.1.32}}
+
{{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
−
{{#set: gene associated=Tiso_gene_322}}
+
{{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=353.228    }}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-10058}}

Latest revision as of 20:10, 21 March 2018

Metabolite CPD-10809

  • smiles:
    • C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
  • common name:
    • 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
  • inchi key:
    • InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
  • molecular weight:
    • 353.228
  • Synonym(s):
    • 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-10809&oldid=46542"