Difference between revisions of "Tiso gene 19373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * smiles: ** C(C1(C(=CC=CC=1)N))(=O)[O-] * common name: ** anthra...") |
(Created page with "Category:Gene == Gene Tiso_gene_19373 == * right end position: ** 1868 * transcription direction: ** POSITIVE * left end position: ** 79 * centisome position: ** 3.323517...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19373 == |
− | * | + | * right end position: |
− | ** | + | ** 1868 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 79 |
− | * | + | * centisome position: |
− | ** | + | ** 3.323517 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ADDALT-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[ADENODEAMIN-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7179]] | ||
+ | * [[SALVADEHYPOX-PWY]] | ||
+ | * [[PWY0-1296]] | ||
+ | * [[PWY-7179-1]] | ||
+ | * [[PWY-6609]] | ||
+ | * [[PWY-6611]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1868}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=79}} | |
− | + | {{#set: centisome position=3.323517 }} | |
− | + | {{#set: reaction associated=ADDALT-RXN|ADENODEAMIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7179|SALVADEHYPOX-PWY|PWY0-1296|PWY-7179-1|PWY-6609|PWY-6611}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:11, 21 March 2018
Gene Tiso_gene_19373
- right end position:
- 1868
- transcription direction:
- POSITIVE
- left end position:
- 79
- centisome position:
- 3.323517
- Synonym(s):
Reactions associated
- Reaction: ADDALT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: ADENODEAMIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation