Difference between revisions of "ALCDH nadp hi"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogena...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] ==
−
* smiles:
+
* direction:
−
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** gibberellin A34
+
** alcohol dehydrogenase (ethanol, NADP), chloroplast
−
* inchi key:
+
−
** InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M
+
−
* molecular weight:
+
−
** 347.387   
+
 
* Synonym(s):
 
* Synonym(s):
−
** GA34
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-6550]]
+
** 1.0 [[ACETALD]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[NADPH]][h] '''=>''' 1.0 [[ETOH]][h] '''+''' 1.0 [[NADP]][h]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 acetaldehyde[h] '''+''' 1.0 H+[h] '''+''' 1.0 NADPH[h] '''=>''' 1.0 ethanol[h] '''+''' 1.0 NADP+[h]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14126]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170025
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=alcohol dehydrogenase (ethanol, NADP), chloroplast}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245079 25245079]
+
{{#set: gene associated=Tiso_gene_14126}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29593 29593]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11868 C11868]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: common name=gibberellin A34}}
+
−
{{#set: inchi key=InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M}}
+
−
{{#set: molecular weight=347.387    }}
+
−
{{#set: common name=GA34}}
+
−
{{#set: produced by=RXN-6550}}
+

Latest revision as of 20:12, 21 March 2018

Reaction ALCDH_nadp_hi

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alcohol dehydrogenase (ethanol, NADP), chloroplast
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetaldehyde[h] + 1.0 H+[h] + 1.0 NADPH[h] => 1.0 ethanol[h] + 1.0 NADP+[h]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALCDH_nadp_hi&oldid=46746"