Difference between revisions of "CPD-558"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14816 == * right end position: ** 4989 * transcription direction: ** POSITIVE * left end position: ** 1405 * centisome position: ** 25.9752...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_14816 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] ==
* right end position:
+
* smiles:
** 4989
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** pimeloyl-CoA
* left end position:
+
* inchi key:
** 1405
+
** InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
* centisome position:
+
* molecular weight:
** 25.975227    
+
** 904.649    
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-carboxyhexanoyl-CoA
 +
** pimelyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[ATPASE-RXN]]
+
* [[7KAPSYN-RXN]]
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12195]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12196]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN0-5462]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
== Pathways associated ==
+
* [[PWY-7184]]
+
* [[PWY-7198]]
+
* [[PWY-6545]]
+
* [[PWY-7210]]
+
 
== External links  ==
 
== External links  ==
{{#set: right end position=4989}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266589 45266589]
{{#set: left end position=1405}}
+
* CHEBI:
{{#set: centisome position=25.975227   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57360 57360]
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
+
* BIGG : pmcoa
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01063 C01063]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: common name=pimeloyl-CoA}}
 +
{{#set: inchi key=InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I}}
 +
{{#set: molecular weight=904.649   }}
 +
{{#set: common name=6-carboxyhexanoyl-CoA|pimelyl-CoA}}
 +
{{#set: consumed by=7KAPSYN-RXN}}

Latest revision as of 20:12, 21 March 2018

Metabolite CPD-558

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • pimeloyl-CoA
  • inchi key:
    • InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
  • molecular weight:
    • 904.649
  • Synonym(s):
    • 6-carboxyhexanoyl-CoA
    • pimelyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.