Difference between revisions of "HDS"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * common name: ** keto-L-sorbose *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HDS HDS] == * direction: ** REVERSIBLE * common name: ** 4-hydroxy-3-methylbut-2-en-1-yl diphosphat...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HDS HDS] ==
* smiles:
+
* direction:
** C(O)C(=O)C(O)C(O)C(O)CO
+
** REVERSIBLE
 
* common name:
 
* common name:
** keto-L-sorbose
+
** 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase
* inchi key:
+
** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
+
* molecular weight:
+
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][h] '''+''' 1.0 [[Protein-Dithiols]][h] '''<=>''' 1.0 [[Protein-Disulfides]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[WATER]][h] '''+''' 1.0 [[HYDROXY-METHYL-BUTENYL-DIP]][h]
* [[RXN-14811]]
+
* With common name(s):
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
** 1.0 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[h] '''+''' 1.0 a protein dithiol[h] '''<=>''' 1.0 a protein disulfide[h] '''+''' 1.0 H+[h] '''+''' 1.0 H2O[h] '''+''' 1.0 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[h]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15758]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904]
+
{{#set: common name=4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_15758}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172]
+
{{#set: in pathway=}}
* METABOLIGHTS : MTBLC13172
+
{{#set: reconstruction category=orthology}}
{{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: common name=keto-L-sorbose}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}}
+
{{#set: molecular weight=180.157    }}
+
{{#set: reversible reaction associated=RXN-14811|L-IDITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 21:13, 21 March 2018

Reaction HDS

  • direction:
    • REVERSIBLE
  • common name:
    • 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links