Difference between revisions of "Tiso gene 1548"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-is...")
(Created page with "Category:Gene == Gene Tiso_gene_1548 == * right end position: ** 8755 * transcription direction: ** NEGATIVE * left end position: ** 7610 * centisome position: ** 32.51719...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] ==
+
== Gene Tiso_gene_1548 ==
* smiles:
+
* right end position:
** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
+
** 8755
* common name:
+
* transcription direction:
** 3-isopropyl-10-(methylthio)-2-oxodecanoate
+
** NEGATIVE
* inchi key:
+
* left end position:
** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
+
** 7610
* molecular weight:
+
* centisome position:
** 274.331    
+
** 32.517197    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-18201]]
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
* [[RXN-18200]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: right end position=8755}}
{{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}}
+
{{#set: transcription direction=NEGATIVE}}
{{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}}
+
{{#set: left end position=7610}}
{{#set: molecular weight=274.331   }}
+
{{#set: centisome position=32.517197   }}
{{#set: consumed by=RXN-18201}}
+
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
{{#set: reversible reaction associated=RXN-18200}}
+

Latest revision as of 20:14, 21 March 2018

Gene Tiso_gene_1548

  • right end position:
    • 8755
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 7610
  • centisome position:
    • 32.517197
  • Synonym(s):

Reactions associated

Pathways associated

External links