Difference between revisions of "Tiso gene 3805"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * common name: ** allantoat...") |
(Created page with "Category:Gene == Gene Tiso_gene_3805 == * Synonym(s): == Reactions associated == * Reaction: 5.3.1.23-RXN ** Source: orthology-synechocystis * Reaction: [[M5TRPI]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3805 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[5.3.1.23-RXN]] |
− | + | ** Source: [[orthology-synechocystis]] | |
− | * [[ | + | * Reaction: [[M5TRPI]] |
− | == | + | ** Source: [[orthology-creinhardtii]] |
+ | == Pathways associated == | ||
+ | * [[PWY-7174]] | ||
+ | * [[PWY-4361]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=5.3.1.23-RXN|M5TRPI}} | |
− | + | {{#set: pathway associated=PWY-7174|PWY-4361}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 21:14, 21 March 2018
Gene Tiso_gene_3805
- Synonym(s):
Reactions associated
- Reaction: 5.3.1.23-RXN
- Source: orthology-synechocystis
- Reaction: M5TRPI
- Source: orthology-creinhardtii