Difference between revisions of "RXN-9657"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-130 CPD1F-130] == * smiles: ** CC(C=CC=C(C=CC1(C(C)(C)CC(CC=1C)O))C)=CC=CC=C(C=CC=C(C=CC2...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] == * direction: ** LEFT-TO-RIGHT * common name: ** crotonyl-[acp] reductase * ec...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-130 CPD1F-130] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] ==
−
* smiles:
+
* direction:
−
** CC(C=CC=C(C=CC1(C(C)(C)CC(CC=1C)O))C)=CC=CC=C(C=CC=C(C=CC2(=C(CC(CC(C)(C)2)O)C))C)C
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** zeaxanthin
+
** crotonyl-[acp] reductase
−
* inchi key:
+
* ec number:
−
** InChIKey=JKQXZKUSFCKOGQ-QAYBQHTQSA-N
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
−
* molecular weight:
+
−
** 568.881   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β,β-carotene-3,3'-diol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7978]]
+
* With identifiers:
−
* [[RXN-13193]]
+
** 1 [[NADH]][c] '''+''' 1 [[Crotonyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Butanoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-7985]]
+
** 1 NADH[c] '''+''' 1 a crotonyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a butyryl-[acp][c] '''+''' 1 NAD+[c]
−
* [[RXN-8026]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[RXN-13185]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR01070261
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=crotonyl-[acp] reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280899 5280899]
+
{{#set: ec number=EC-1.3.1.9}}
−
* HMDB : HMDB02789
+
{{#set: gene associated=Tiso_gene_10778}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5971}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06098 C06098]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.chemspider.com/Chemical-Structure.4444421.html 4444421]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27547 27547]
+
−
* METABOLIGHTS : MTBLC27547
+
−
{{#set: smiles=CC(C=CC=C(C=CC1(C(C)(C)CC(CC=1C)O))C)=CC=CC=C(C=CC=C(C=CC2(=C(CC(CC(C)(C)2)O)C))C)C}}
+
−
{{#set: common name=zeaxanthin}}
+
−
{{#set: inchi key=InChIKey=JKQXZKUSFCKOGQ-QAYBQHTQSA-N}}
+
−
{{#set: molecular weight=568.881    }}
+
−
{{#set: common name=β,β-carotene-3,3'-diol}}
+
−
{{#set: consumed by=RXN-7978|RXN-13193}}
+
−
{{#set: produced by=RXN-7985|RXN-8026}}
+
−
{{#set: reversible reaction associated=RXN-13185}}
+

Latest revision as of 20:15, 21 March 2018

Reaction RXN-9657

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • crotonyl-[acp] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADH[c] + 1 a crotonyl-[acp][c] + 1 H+[c] => 1 a butyryl-[acp][c] + 1 NAD+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"crotonyl-[acp] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9657&oldid=47174"