Difference between revisions of "Tiso gene 12131"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * common name: ** 2-oleoyl...") |
(Created page with "Category:Gene == Gene Tiso_gene_12131 == * right end position: ** 3807 * transcription direction: ** NEGATIVE * left end position: ** 57 * centisome position: ** 0.7842597...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12131 == |
− | * | + | * right end position: |
− | ** | + | ** 3807 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 57 |
− | * | + | * centisome position: |
− | ** | + | ** 0.78425974 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * Reaction: [[3.5.1.98-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3807}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=57}} | |
− | + | {{#set: centisome position=0.78425974 }} | |
− | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_12131
- right end position:
- 3807
- transcription direction:
- NEGATIVE
- left end position:
- 57
- centisome position:
- 0.78425974
- Synonym(s):
Reactions associated
- Reaction: 3.5.1.98-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation