Difference between revisions of "Tiso gene 16519"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))...")
(Created page with "Category:Gene == Gene Tiso_gene_16519 == * Synonym(s): == Reactions associated == * Reaction: 3.2.1.39-RXN ** Source: orthology-esiliculosus == Pathways associate...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] ==
+
== Gene Tiso_gene_16519 ==
* smiles:
+
** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
* common name:
+
** XXLG xyloglucan oligosaccharide
+
* inchi key:
+
** InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N
+
* molecular weight:
+
** 1225.073   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12398]]
+
* Reaction: [[3.2.1.39-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.2.1.39-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940123 52940123]
+
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: common name=XXLG xyloglucan oligosaccharide}}
+
{{#set: inchi key=InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N}}
+
{{#set: molecular weight=1225.073    }}
+
{{#set: consumed by=RXN-12398}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_16519

  • Synonym(s):

Reactions associated

Pathways associated

External links