Difference between revisions of "Tiso gene 14064"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...")
(Created page with "Category:Gene == Gene Tiso_gene_14064 == * right end position: ** 5744 * transcription direction: ** POSITIVE * left end position: ** 1133 * centisome position: ** 19.3015...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
+
== Gene Tiso_gene_14064 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
+
** 5744
−
* common name:
+
* transcription direction:
−
** apo-4'-lycopenal
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
+
** 1133
−
* molecular weight:
+
* centisome position:
−
** 482.748    
+
** 19.301533    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-12086]]
−
* [[RXN-11999]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-12579]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[TRIACYLGLYCEROL-LIPASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[LIPAS-PWY]]
 +
* [[PWY-6857]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5744}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}}
+
{{#set: left end position=1133}}
−
{{#set: common name=apo-4'-lycopenal}}
+
{{#set: centisome position=19.301533    }}
−
{{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}}
+
{{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}}
−
{{#set: molecular weight=482.748    }}
+
{{#set: pathway associated=LIPAS-PWY|PWY-6857}}
−
{{#set: produced by=RXN-11999}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_14064

  • right end position:
    • 5744
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1133
  • centisome position:
    • 19.301533
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14064&oldid=47296"