Difference between revisions of "Tiso gene 9630"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * common name: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_9630 == * right end position: ** 6630 * transcription direction: ** POSITIVE * left end position: ** 4240 * centisome position: ** 46.28315...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9630 == |
− | * | + | * right end position: |
− | ** | + | ** 6630 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4240 |
− | * | + | * centisome position: |
− | ** | + | ** 46.283157 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CHORISMATE-SYNTHASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6163]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6630}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4240}} | |
− | + | {{#set: centisome position=46.283157 }} | |
− | + | {{#set: reaction associated=CHORISMATE-SYNTHASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-6163}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 21:16, 21 March 2018
Gene Tiso_gene_9630
- right end position:
- 6630
- transcription direction:
- POSITIVE
- left end position:
- 4240
- centisome position:
- 46.283157
- Synonym(s):
Reactions associated
- Reaction: CHORISMATE-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation