Difference between revisions of "CPD-17624"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14139 RXN-14139] == * direction: ** LEFT-TO-RIGHT * common name: ** inosine_triphosphate * ec n...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-]...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14139 RXN-14139] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** inosine_triphosphate
+
** ω-carboxy-(9Z)-octadec-9-enoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.6.1.9 EC-3.6.1.9]
+
** InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
 +
* molecular weight:
 +
** 1056.928   
 
* Synonym(s):
 
* Synonym(s):
 +
** 18-carboxyl oleoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[WATER]][c] '''+''' 1 [[UTP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[UMP]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-16418]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H2O[c] '''+''' 1 UTP[c] '''=>''' 1 diphosphate[c] '''+''' 1 UMP[c] '''+''' 1 H+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Tiso_gene_18792]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Tiso_gene_18793]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
** Source: [[orthology-athaliana]]
+
== Pathways  ==
+
* [[PWY-7821]], tunicamycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7821 PWY-7821]
+
** '''2''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-athaliana]]
+
*** Tool: [[pantograph]]
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29398 29398]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820430 91820430]
* LIGAND-RXN:
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.genome.jp/dbget-bin/www_bget?R00662 R00662]
+
{{#set: common name=ω-carboxy-(9Z)-octadec-9-enoyl-CoA}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I}}
{{#set: common name=inosine_triphosphate}}
+
{{#set: molecular weight=1056.928    }}
{{#set: ec number=EC-3.6.1.9}}
+
{{#set: common name=18-carboxyl oleoyl-CoA}}
{{#set: gene associated=Tiso_gene_18792|Tiso_gene_18793}}
+
{{#set: produced by=RXN-16418}}
{{#set: in pathway=PWY-7821}}
+
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-17624

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • ω-carboxy-(9Z)-octadec-9-enoyl-CoA
  • inchi key:
    • InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
  • molecular weight:
    • 1056.928
  • Synonym(s):
    • 18-carboxyl oleoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.