Difference between revisions of "RXN-14139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14139 RXN-14139] == * direction: ** LEFT-TO-RIGHT * common name: ** inosine_triphosphate * ec n...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14139 RXN-14139] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (3S)-hydroxyadipyl-CoA
+
** inosine_triphosphate
−
* inchi key:
+
* ec number:
−
** InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I
+
** [http://enzyme.expasy.org/EC/3.6.1.9 EC-3.6.1.9]
−
* molecular weight:
+
−
** 906.621   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[WATER]][c] '''+''' 1 [[UTP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[UMP]][c] '''+''' 1 [[PROTON]][c]
−
* [[RXN-2425]]
+
* With common name(s):
−
* [[RXN0-2044]]
+
** 1 H2O[c] '''+''' 1 UTP[c] '''=>''' 1 diphosphate[c] '''+''' 1 UMP[c] '''+''' 1 H+[c]
−
* [[RXN0-6513]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18792]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18793]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-7821]], tunicamycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7821 PWY-7821]
 +
** '''2''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679061 70679061]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29398 29398]
−
* HMDB : HMDB12475
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00662 R00662]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70990 70990]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=inosine_triphosphate}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14145 C14145]
+
{{#set: ec number=EC-3.6.1.9}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_18792|Tiso_gene_18793}}
−
{{#set: common name=(3S)-hydroxyadipyl-CoA}}
+
{{#set: in pathway=PWY-7821}}
−
{{#set: inchi key=InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=906.621    }}
+
{{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation}}
−
{{#set: reversible reaction associated=RXN-2425|RXN0-2044|RXN0-6513}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:17, 21 March 2018

Reaction RXN-14139

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • inosine_triphosphate
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 UTP[c] => 1 diphosphate[c] + 1 UMP[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7821, tunicamycin biosynthesis: PWY-7821
    • 2 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14139&oldid=47476"