Difference between revisions of "CPD-10244"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * common name: ** doc...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] |
* common name: | * common name: | ||
| − | ** | + | ** docosahexaenoate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 327.486 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** docosahexaenoic acid |
| − | ** | + | ** DHA |
| − | ** | + | ** all-cis-docosa-4,7,10,13,16,19-hexaenoate |
| − | ** | + | ** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate |
| − | ** | + | ** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16138]] |
| + | * [[RXN-16017]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-16063]] |
== External links == | == External links == | ||
| − | + | * LIPID_MAPS : LMFA01030185 | |
| − | * LIPID_MAPS : | + | |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925] |
| − | * | + | * DRUGBANK : DB03756 |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016] |
| − | * | + | * HMDB : HMDB02183 |
| − | {{#set: smiles= | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}} |
| − | {{#set: common name= | + | {{#set: common name=docosahexaenoate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=327.486 }} |
| − | {{#set: common name= | + | {{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}} |
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-16138|RXN-16017}} |
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=RXN-16063}} |
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-10244
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
- common name:
- docosahexaenoate
- inchi key:
- InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
- molecular weight:
- 327.486
- Synonym(s):
- docosahexaenoic acid
- DHA
- all-cis-docosa-4,7,10,13,16,19-hexaenoate
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-" cannot be used as a page name in this wiki.
