Difference between revisions of "RXN0-366"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-366 RXN0-366] == * direction: ** LEFT-TO-RIGHT * common name: ** guanosine hydrolase ** nucleo...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-366 RXN0-366] ==
−
* smiles:
+
* direction:
−
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (R)-NADHX
+
** guanosine hydrolase
−
* inchi key:
+
** nucleoside_hydrolase
−
** InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/3.2.2.1 EC-3.2.2.1]
−
** 681.445   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12754]]
+
** 1 [[WATER]][c] '''+''' 1 [[GUANOSINE]][c] '''=>''' 1 [[GUANINE]][c] '''+''' 1 [[D-Ribofuranose]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 guanosine[c] '''=>''' 1 guanine[c] '''+''' 1 D-ribofuranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11910]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12995]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6599]], guanine and guanosine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6599 PWY-6599]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-6606]], guanosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6606 PWY-6606]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927860 56927860]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30774 30774]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64075 64075]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01677 R01677]
−
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=(R)-NADHX}}
+
{{#set: common name=guanosine hydrolase}}
−
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L}}
+
{{#set: common name=nucleoside_hydrolase}}
−
{{#set: molecular weight=681.445    }}
+
{{#set: ec number=EC-3.2.2.1}}
−
{{#set: common name=(6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
+
{{#set: gene associated=Tiso_gene_11910|Tiso_gene_12995}}
−
{{#set: produced by=RXN-12754}}
+
{{#set: in pathway=PWY-6599|PWY-6606}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:17, 21 March 2018

Reaction RXN0-366

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • guanosine hydrolase
    • nucleoside_hydrolase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6599, guanine and guanosine salvage II: PWY-6599
    • 2 reactions found over 2 reactions in the full pathway
  • PWY-6606, guanosine nucleotides degradation II: PWY-6606
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-366&oldid=47526"