Difference between revisions of "Tiso gene 2450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13227 CPD-13227] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC...")
(Created page with "Category:Gene == Gene Tiso_gene_2450 == * right end position: ** 8413 * transcription direction: ** POSITIVE * left end position: ** 8043 * centisome position: ** 41.44808...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13227 CPD-13227] ==
+
== Gene Tiso_gene_2450 ==
−
* smiles:
+
* right end position:
−
** CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))
+
** 8413
−
* common name:
+
* transcription direction:
−
** N,N',N''-triacetylchitotriose
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N
+
** 8043
−
* molecular weight:
+
* centisome position:
−
** 627.598    
+
** 41.448082    
 
* Synonym(s):
 
* Synonym(s):
−
** triacetylchitotriose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12626]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8413}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10930193 10930193]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=8043}}
−
** [http://www.chemspider.com/Chemical-Structure.392429.html 392429]
+
{{#set: centisome position=41.448082   }}
−
* CHEBI:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71404 71404]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: smiles=CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))}}
+
−
{{#set: common name=N,N',N''-triacetylchitotriose}}
+
−
{{#set: inchi key=InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N}}
+
−
{{#set: molecular weight=627.598   }}
+
−
{{#set: common name=triacetylchitotriose}}
+
−
{{#set: consumed by=RXN-12626}}
+

Latest revision as of 21:18, 21 March 2018

Gene Tiso_gene_2450

  • right end position:
    • 8413
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8043
  • centisome position:
    • 41.448082
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2450&oldid=47636"