Difference between revisions of "CPD1F-90"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6116 == * right end position: ** 2774 * transcription direction: ** POSITIVE * left end position: ** 2107 * centisome position: ** 16.8143...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == |
| − | * | + | * smiles: |
| − | ** | + | ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) |
| − | * | + | * common name: |
| − | ** | + | ** kaempferol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 285.232 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-13935]] |
| − | * | + | * [[RXN-12510]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN1F-93]] |
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202062 25202062] |
| − | {{#set: | + | * HMDB : HMDB05801 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58573 58573] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05903 C05903] | ||
| + | {{#set: smiles=C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)}} | ||
| + | {{#set: common name=kaempferol}} | ||
| + | {{#set: inchi key=InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=285.232 }} | ||
| + | {{#set: consumed by=RXN-13935|RXN-12510}} | ||
| + | {{#set: produced by=RXN1F-93}} | ||
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite CPD1F-90
- smiles:
- C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)
- common name:
- kaempferol
- inchi key:
- InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M
- molecular weight:
- 285.232
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)" cannot be used as a page name in this wiki.
