Difference between revisions of "Tiso gene 14132"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * smiles: ** C(C([N+])C(=O)[O-])S([O-])=O * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_14132 == * right end position: ** 5682 * transcription direction: ** POSITIVE * left end position: ** 4217 * centisome position: ** 72.4819...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14132 == |
− | * | + | * right end position: |
− | ** | + | ** 5682 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4217 |
− | * | + | * centisome position: |
− | ** | + | ** 72.48196 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[UDPNACETYLMURAMATEDEHYDROG-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-6386]] | ||
+ | * [[PWY-6387]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5682}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4217}} | |
− | + | {{#set: centisome position=72.48196 }} | |
− | + | {{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}} | |
− | + | {{#set: pathway associated=PWY-6386|PWY-6387}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:18, 21 March 2018
Gene Tiso_gene_14132
- right end position:
- 5682
- transcription direction:
- POSITIVE
- left end position:
- 4217
- centisome position:
- 72.48196
- Synonym(s):
Reactions associated
- Reaction: UDPNACETYLMURAMATEDEHYDROG-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation