Difference between revisions of "RXN-1106"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1106 RXN-1106] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1106 RXN-1106] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** GDP-β-L-galactose
+
** [http://enzyme.expasy.org/EC/1.2.1.44 EC-1.2.1.44]
−
* inchi key:
+
−
** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
+
−
* molecular weight:
+
−
** 603.329   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[FERULOYL-COA]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CONIFERYL-ALDEHYDE]][c]
−
* [[RXN-7772]]
+
* With common name(s):
−
* [[RXN-1882]]
+
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 feruloyl-CoA[c] '''=>''' 1 NADP+[c] '''+''' 1 coenzyme A[c] '''+''' 1 coniferaldehyde[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11016]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_15272]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9504]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6027]], capsiconiate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6027 PWY-6027]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361]
 +
** '''7''' reactions found over '''15''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02193 R02193]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454]
+
{{#set: ec number=EC-1.2.1.44}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_11016|Tiso_gene_15272|Tiso_gene_9504}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280]
+
{{#set: in pathway=PWY-6027|PWY-361}}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=GDP-β-L-galactose}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=603.329    }}
+
−
{{#set: reversible reaction associated=RXN-7772|RXN-1882}}
+

Latest revision as of 20:19, 21 March 2018

Reaction RXN-1106

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6027, capsiconiate biosynthesis: PWY-6027
    • 1 reactions found over 4 reactions in the full pathway
  • PWY-361, phenylpropanoid biosynthesis: PWY-361
    • 7 reactions found over 15 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-1106&oldid=47719"