Difference between revisions of "Enoylpimeloyl-ACP-methyl-esters"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23))) * com...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylpimeloyl-ACP-methyl-esters Enoylpimeloyl-ACP-methyl-esters] == * common name: ** an enoylp...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylpimeloyl-ACP-methyl-esters Enoylpimeloyl-ACP-methyl-esters] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an enoylpimeloyl-[acp] methyl ester |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** an enoylpimelyl-[acyl-carrier protein] methyl ester |
− | ** | + | ** an enoylpimelyl-[acp] methyl ester |
+ | ** an enoylpimeloyl-[acyl-carrier protein] methyl ester | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11482]] |
− | * [[ | + | * [[EPMEACPR]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11481]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an enoylpimeloyl-[acp] methyl ester}} | |
− | + | {{#set: common name=an enoylpimelyl-[acyl-carrier protein] methyl ester|an enoylpimelyl-[acp] methyl ester|an enoylpimeloyl-[acyl-carrier protein] methyl ester}} | |
− | + | {{#set: consumed by=RXN-11482|EPMEACPR}} | |
− | + | {{#set: produced by=RXN-11481}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | {{#set: | + |
Latest revision as of 21:19, 21 March 2018
Contents
Metabolite Enoylpimeloyl-ACP-methyl-esters
- common name:
- an enoylpimeloyl-[acp] methyl ester
- Synonym(s):
- an enoylpimelyl-[acyl-carrier protein] methyl ester
- an enoylpimelyl-[acp] methyl ester
- an enoylpimeloyl-[acyl-carrier protein] methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an enoylpimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.
- "an enoylpimelyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.
- "an enoylpimelyl-[acp] methyl ester" cannot be used as a page name in this wiki.
- "an enoylpimeloyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.