Difference between revisions of "2.7.10.1-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * common name: ** 4-methyl-3-o...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.10.1-RXN 2.7.10.1-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.10.1-RXN 2.7.10.1-RXN] ==
−
* smiles:
+
* direction:
−
** CC1(=C(OC(C1)=O)CC([O-])=O)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 4-methyl-3-oxoadipate-enol-lactone
+
** ORF
−
* inchi key:
+
* ec number:
−
** InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/2.7.10.2 EC-2.7.10.2]
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.7.12.1 EC-2.7.12.1]
−
** 155.13   
+
** [http://enzyme.expasy.org/EC/2.7.10.1 EC-2.7.10.1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10083]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Protein-Tyrosines]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Protein-tyrosine-phosphates]][c] '''+''' 1 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a [protein]-L-tyrosine[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 a [protein]-L-tyrosine phosphate[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5584]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_1492]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_1810]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2393]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_10356]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9800]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_6071]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17980]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18523]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17047]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_10355]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14940]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14941]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15652]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12229]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123582 44123582]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02584 R02584]
−
{{#set: smiles=CC1(=C(OC(C1)=O)CC([O-])=O)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=4-methyl-3-oxoadipate-enol-lactone}}
+
{{#set: common name=ORF}}
−
{{#set: inchi key=InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M}}
+
{{#set: ec number=EC-2.7.10.2}}
−
{{#set: molecular weight=155.13    }}
+
{{#set: ec number=EC-2.7.12.1}}
−
{{#set: consumed by=RXN-10083}}
+
{{#set: ec number=EC-2.7.10.1}}
 +
{{#set: gene associated=Tiso_gene_5584|Tiso_gene_1492|Tiso_gene_1810|Tiso_gene_2393|Tiso_gene_10356|Tiso_gene_9800|Tiso_gene_6071|Tiso_gene_17980|Tiso_gene_18523|Tiso_gene_17047|Tiso_gene_10355|Tiso_gene_14940|Tiso_gene_14941|Tiso_gene_15652|Tiso_gene_12229}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:19, 21 March 2018

Reaction 2.7.10.1-RXN

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.7.10.1-RXN&oldid=47818"