Difference between revisions of "CPD-13378"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8625 == * right end position: ** 2577 * transcription direction: ** NEGATIVE * left end position: ** 125 * centisome position: ** 1.2429154...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8625 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
* right end position:
+
* smiles:
** 2577
+
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
* transcription direction:
+
* common name:
** NEGATIVE
+
** XLLG xyloglucan oligosaccharide
* left end position:
+
* inchi key:
** 125
+
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
* centisome position:
+
* molecular weight:
** 1.2429154    
+
** 1387.215    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[PYRROLINECARBREDUCT-RXN]]
+
* [[RXN-12400]]
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-esiliculosus]]
+
* Reaction: [[R01251]]
+
** Source: [[orthology-synechocystis]]
+
* Reaction: [[RXN66-546]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
== Pathways associated ==
+
* [[PROSYN-PWY]]
+
* [[ARG-PRO-PWY]]
+
* [[PWY-6344]]
+
* [[PWY-4981]]
+
* [[PWY-3341]]
+
 
== External links  ==
 
== External links  ==
{{#set: right end position=2577}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
{{#set: left end position=125}}
+
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
{{#set: centisome position=1.2429154   }}
+
{{#set: common name=XLLG xyloglucan oligosaccharide}}
{{#set: reaction associated=PYRROLINECARBREDUCT-RXN|R01251|RXN66-546}}
+
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
{{#set: pathway associated=PROSYN-PWY|ARG-PRO-PWY|PWY-6344|PWY-4981|PWY-3341}}
+
{{#set: molecular weight=1387.215   }}
 +
{{#set: consumed by=RXN-12400}}

Latest revision as of 20:20, 21 March 2018

Metabolite CPD-13378

  • smiles:
    • C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
  • common name:
    • XLLG xyloglucan oligosaccharide
  • inchi key:
    • InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
  • molecular weight:
    • 1387.215
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links