Difference between revisions of "25-DIDEHYDRO-D-GLUCONATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15884 == * right end position: ** 1678 * transcription direction: ** NEGATIVE * left end position: ** 251 * centisome position: ** 5.30319...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25-DIDEHYDRO-D-GLUCONATE 25-DIDEHYDRO-D-GLUCONATE] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)O)O)=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25-DIDEHYDRO-D-GLUCONATE 25-DIDEHYDRO-D-GLUCONATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(C(C(C(C([O-])=O)=O)O)O)=O)O |
− | * | + | * common name: |
− | ** | + | ** 2,5-didehydro-D-gluconate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 191.117 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2,5-diketo-D-gluconate | ||
+ | ** 2,5-diketogluconic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[1.1.1.274-RXN]] | |
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548631 9548631] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.7827554.html 7827554] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11449 11449] |
+ | * BIGG : 25dkglcn | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02780 C02780] | ||
+ | {{#set: smiles=C(C(C(C(C(C([O-])=O)=O)O)O)=O)O}} | ||
+ | {{#set: common name=2,5-didehydro-D-gluconate}} | ||
+ | {{#set: inchi key=InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M}} | ||
+ | {{#set: molecular weight=191.117 }} | ||
+ | {{#set: common name=2,5-diketo-D-gluconate|2,5-diketogluconic acid}} | ||
+ | {{#set: reversible reaction associated=1.1.1.274-RXN}} |
Latest revision as of 20:20, 21 March 2018
Contents
Metabolite 25-DIDEHYDRO-D-GLUCONATE
- smiles:
- C(C(C(C(C(C([O-])=O)=O)O)O)=O)O
- common name:
- 2,5-didehydro-D-gluconate
- inchi key:
- InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M
- molecular weight:
- 191.117
- Synonym(s):
- 2,5-diketo-D-gluconate
- 2,5-diketogluconic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(C(C(C(C([O-])=O)=O)O)O)=O)O" cannot be used as a page name in this wiki.