Difference between revisions of "Tiso gene 17819"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_17819 == * right end position: ** 2031 * transcription direction: ** NEGATIVE * left end position: ** 17 * centisome position: ** 0.4941860...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] ==
+
== Gene Tiso_gene_17819 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 2031
−
* common name:
+
* transcription direction:
−
** OPC6-CoA
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J
+
** 17
−
* molecular weight:
+
* centisome position:
−
** 1011.867    
+
** 0.49418607    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10706]]
+
* Reaction: [[RXN-11109]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10699]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2031}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237133 44237133]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: left end position=17}}
−
{{#set: common name=OPC6-CoA}}
+
{{#set: centisome position=0.49418607   }}
−
{{#set: inchi key=InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J}}
+
{{#set: reaction associated=RXN-11109}}
−
{{#set: molecular weight=1011.867   }}
+
−
{{#set: consumed by=RXN-10706}}
+
−
{{#set: produced by=RXN-10699}}
+

Latest revision as of 20:20, 21 March 2018

Gene Tiso_gene_17819

  • right end position:
    • 2031
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 17
  • centisome position:
    • 0.49418607
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17819&oldid=47924"