Difference between revisions of "CPD66-29"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDCM ATDCM] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dCMP phosphotransferase * Synon...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * smiles: ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) |
* common name: | * common name: | ||
| − | ** | + | ** 5-androstene-3,17-dione |
| + | * inchi key: | ||
| + | ** InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N | ||
| + | * molecular weight: | ||
| + | ** 286.413 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** androst-5-ene-3,17-dione | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-342]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20252 C20252] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.543261.html 543261] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83865 83865] |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160531 160531] | ||
| + | {{#set: smiles=CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)}} | ||
| + | {{#set: common name=5-androstene-3,17-dione}} | ||
| + | {{#set: inchi key=InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N}} | ||
| + | {{#set: molecular weight=286.413 }} | ||
| + | {{#set: common name=androst-5-ene-3,17-dione}} | ||
| + | {{#set: produced by=RXN66-342}} | ||
Latest revision as of 21:20, 21 March 2018
Contents
Metabolite CPD66-29
- smiles:
- CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)
- common name:
- 5-androstene-3,17-dione
- inchi key:
- InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N
- molecular weight:
- 286.413
- Synonym(s):
- androst-5-ene-3,17-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)" cannot be used as a page name in this wiki.
