Difference between revisions of "RXN-8988"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * smiles: ** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8988 RXN-8988] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8988 RXN-8988] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** UDP-α-D-glucuronate
+
** [http://enzyme.expasy.org/EC/6.2.1.4 EC-6.2.1.4]
−
* inchi key:
+
−
** InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K
+
−
* molecular weight:
+
−
** 577.265   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (UDP-GlcA)1
 
−
** UDP-D-glucuronic acid
 
−
** UDP-glucuronic acid
 
−
** udp-glcua
 
−
** UDP-glucuronate
 
−
** uridine diphosphate glucuronate
 
−
** uridine diphosphate glucuronic acid
 
−
** UDP-D-glucuronate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14361]]
+
* With identifiers:
−
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
+
** 1 [[CO-A]][c] '''+''' 1 [[GTP]][c] '''+''' 1 [[ITACONATE]][c] '''=>''' 1 [[CPD-1137]][c] '''+''' 1 [[GDP]][c] '''+''' 1 [[Pi]][c]
−
* [[RXN-9000]]
+
* With common name(s):
−
* [[RXN-10618]]
+
** 1 coenzyme A[c] '''+''' 1 GTP[c] '''+''' 1 itaconate[c] '''=>''' 1 itaconyl-CoA[c] '''+''' 1 GDP[c] '''+''' 1 phosphate[c]
−
* [[RXN-10619]]
+
 
−
* [[RXN-10616]]
+
== Genes associated with this reaction  ==
−
* [[RXN-10617]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-11060]]
+
* Gene: [[Tiso_gene_11866]]
−
* [[RXN66-83]]
+
** Source: [[orthology-esiliculosus]]
−
* [[UGDC]]
+
== Pathways  ==
−
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
+
* [[PWY-5749]], itaconate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5749 PWY-5749]
−
* [[RXN-13608]]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
−
* [[RXN-10609]]
+
== Reconstruction information  ==
−
* [[RXN-10608]]
+
* Category: [[orthology]]
−
* [[RXN-10607]]
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-10606]]
+
*** Tool: [[pantograph]]
−
* [[RXN-13607]]
+
−
* [[2.4.1.135-RXN]]
+
−
* [[RXN66-168]]
+
−
* [[RXN-10784]]
+
−
* [[2.4.1.225-RXN]]
+
−
* [[RXN66-162]]
+
−
== Reaction(s) known to produce the compound ==
+
−
* [[GLCUR1PUT]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[2.7.7.44-RXN]]
+
−
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 2616-64-0
+
* LIGAND-RXN:
−
* BIGG : udpglcur
+
** [http://www.genome.jp/dbget-bin/www_bget?R02405 R02405]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202620 25202620]
+
{{#set: ec number=EC-6.2.1.4}}
−
* HMDB : HMDB00935
+
{{#set: gene associated=Tiso_gene_11866}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5749}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00167 C00167]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58052 58052]
+
{{#set: reconstruction tool=pantograph}}
−
* METABOLIGHTS : MTBLC58052
+
−
{{#set: smiles=C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)}}
+
−
{{#set: common name=UDP-α-D-glucuronate}}
+
−
{{#set: inchi key=InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K}}
+
−
{{#set: molecular weight=577.265    }}
+
−
{{#set: common name=(UDP-GlcA)1|UDP-D-glucuronic acid|UDP-glucuronic acid|udp-glcua|UDP-glucuronate|uridine diphosphate glucuronate|uridine diphosphate glucuronic acid|UDP-D-glucuronate}}
+
−
{{#set: consumed by=RXN-14361|UDP-GLUCURONATE-DECARBOXYLASE-RXN|RXN-9000|RXN-10618|RXN-10619|RXN-10616|RXN-10617|RXN-11060|RXN66-83|UGDC|UDP-GLUCURONOSYLTRANSFERASE-RXN|RXN-13608|RXN-10609|RXN-10608|RXN-10607|RXN-10606|RXN-13607|2.4.1.135-RXN|RXN66-168|RXN-10784|2.4.1.225-RXN|RXN66-162}}
+
−
{{#set: produced by=GLCUR1PUT}}
+
−
{{#set: reversible reaction associated=2.7.7.44-RXN|UDP-GLUCURONATE-4-EPIMERASE-RXN}}
+

Latest revision as of 21:20, 21 March 2018

Reaction RXN-8988

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 GTP[c] + 1 itaconate[c] => 1 itaconyl-CoA[c] + 1 GDP[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5749, itaconate degradation: PWY-5749
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8988&oldid=47954"