Difference between revisions of "CPDQT-37"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * smiles: ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(4'-meth...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] |
* common name: | * common name: | ||
| − | ** | + | ** 3-(4'-methylthio)butylmalate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 234.267 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-(4'-methylthio)butylmalic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXNQT-4168]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-18206]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles=C( | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237164 44237164] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: common name=3-(4'-methylthio)butylmalate}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L}} |
| − | {{#set: | + | {{#set: molecular weight=234.267 }} |
| + | {{#set: common name=3-(4'-methylthio)butylmalic acid}} | ||
| + | {{#set: consumed by=RXNQT-4168}} | ||
| + | {{#set: reversible reaction associated=RXN-18206}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPDQT-37
- smiles:
- CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-(4'-methylthio)butylmalate
- inchi key:
- InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L
- molecular weight:
- 234.267
- Synonym(s):
- 3-(4'-methylthio)butylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
