Difference between revisions of "CPD-8985"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14796 RXN-14796] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == * smiles: ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) * common name: ** (+)-(...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14796 RXN-14796] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)
 
* common name:
 
* common name:
−
** acyl-coenzyme_a_oxidase
+
** (+)-(1R,2R)-1,2-diphenylethane-1,2-diol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
+
** InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N
 +
* molecular weight:
 +
** 214.263   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-15684]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-15685]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[3.3.2.9-RXN]]
−
** 1 oxygen[c] '''+''' 1 5-cis, 7-trans-tetradecadienoyl-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_18566]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7340]], 9-cis, 11-trans-octadecadienoyl-CoA degradation (isomerase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7340 PWY-7340]
+
−
** '''3''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=acyl-coenzyme_a_oxidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=853019 853019]
−
{{#set: ec number=EC-1.3.3.6}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_18566}}
+
** [http://www.chemspider.com/Chemical-Structure.745456.html 745456]
−
{{#set: in pathway=PWY-7340}}
+
* HMDB : HMDB12111
−
{{#set: reconstruction category=orthology|annotation}}
+
* CHEBI:
−
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50014 50014]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16015 C16015]
 +
{{#set: smiles=C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)}}
 +
{{#set: common name=(+)-(1R,2R)-1,2-diphenylethane-1,2-diol}}
 +
{{#set: inchi key=InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N}}
 +
{{#set: molecular weight=214.263    }}
 +
{{#set: reversible reaction associated=3.3.2.9-RXN}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-8985

  • smiles:
    • C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)
  • common name:
    • (+)-(1R,2R)-1,2-diphenylethane-1,2-diol
  • inchi key:
    • InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N
  • molecular weight:
    • 214.263
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8985&oldid=48036"