Difference between revisions of "Tetradec-2-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == * smiles: ** CN(C1(C=CC=CC=1))C * common name: ** N,N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tetradec-2-enoyl-ACPs Tetradec-2-enoyl-ACPs] == * common name: ** a trans tetradec-2-enoyl-[acp...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tetradec-2-enoyl-ACPs Tetradec-2-enoyl-ACPs] ==
* smiles:
+
** CN(C1(C=CC=CC=1))C
+
 
* common name:
 
* common name:
** N,N-dimethylaniline
+
** a trans tetradec-2-enoyl-[acp]
* inchi key:
+
** InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N
+
* molecular weight:
+
** 121.182   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.13.8-RXN]]
+
* [[RXN-9662]]
 +
* [[RXN-9538]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9537]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans tetradec-2-enoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=949 949]
+
{{#set: consumed by=RXN-9662|RXN-9538}}
* NCI:
+
{{#set: produced by=RXN-9537}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=7195 7195]
+
* HMDB : HMDB01020
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02846 C02846]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.924.html 924]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16269 16269]
+
{{#set: smiles=CN(C1(C=CC=CC=1))C}}
+
{{#set: common name=N,N-dimethylaniline}}
+
{{#set: inchi key=InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N}}
+
{{#set: molecular weight=121.182    }}
+
{{#set: consumed by=1.14.13.8-RXN}}
+

Latest revision as of 21:21, 21 March 2018

Metabolite Tetradec-2-enoyl-ACPs

  • common name:
    • a trans tetradec-2-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans tetradec-2-enoyl-[acp" cannot be used as a page name in this wiki.