Difference between revisions of "RXN-12347"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * common name: ** trans-caff...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12347 RXN-12347] == * direction: ** LEFT-TO-RIGHT * common name: ** s-adenosylmethionine:diacyl...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12347 RXN-12347] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** s-adenosylmethionine:diacylglycerol_3-amino-3-carboxypropyl_transferase |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[Diacylglycerolhomoserines]][c] '''+''' 1 [[5-METHYLTHIOADENOSINE]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 a diacylglycerolhomoserine[c] '''+''' 1 S-methyl-5'-thioadenosine[c] '''+''' 1 H+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14329]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6795]], diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6795 PWY-6795] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=s-adenosylmethionine:diacylglycerol_3-amino-3-carboxypropyl_transferase}} | |
− | + | {{#set: gene associated=Tiso_gene_14329}} | |
− | + | {{#set: in pathway=PWY-6795}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:21, 21 March 2018
Contents
Reaction RXN-12347
- direction:
- LEFT-TO-RIGHT
- common name:
- s-adenosylmethionine:diacylglycerol_3-amino-3-carboxypropyl_transferase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DIACYLGLYCEROL[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 Diacylglycerolhomoserines[c] + 1 5-METHYLTHIOADENOSINE[c] + 1 PROTON[c]
- With common name(s):
- 1 a 1,2-diacyl-sn-glycerol[c] + 1 S-adenosyl-L-methionine[c] => 1 a diacylglycerolhomoserine[c] + 1 S-methyl-5'-thioadenosine[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14329
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-6795, diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis: PWY-6795
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation