Difference between revisions of "CPD-4586"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8742 == * right end position: ** 6457 * transcription direction: ** NEGATIVE * left end position: ** 136 * centisome position: ** 1.367659...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == * smiles: ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == |
| − | * | + | * smiles: |
| − | ** | + | ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5))) |
| − | * | + | * common name: |
| − | ** | + | ** dihydrodemethylsterigmatocystin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 312.278 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-9500]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20444 C20444] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4588953.html 4588953] |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20832874 20832874] | ||
| + | * HMDB : HMDB33658 | ||
| + | {{#set: smiles=C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))}} | ||
| + | {{#set: common name=dihydrodemethylsterigmatocystin}} | ||
| + | {{#set: inchi key=InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N}} | ||
| + | {{#set: molecular weight=312.278 }} | ||
| + | {{#set: consumed by=RXN-9500}} | ||
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite CPD-4586
- smiles:
- C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
- common name:
- dihydrodemethylsterigmatocystin
- inchi key:
- InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
- molecular weight:
- 312.278
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))" cannot be used as a page name in this wiki.
