Difference between revisions of "Tiso gene 18825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * common na...")
(Created page with "Category:Gene == Gene Tiso_gene_18825 == * right end position: ** 2100 * transcription direction: ** POSITIVE * left end position: ** 5 * centisome position: ** 0.18050541...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] ==
+
== Gene Tiso_gene_18825 ==
−
* smiles:
+
* right end position:
−
** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
+
** 2100
−
* common name:
+
* transcription direction:
−
** hypoglycin B
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
+
** 5
−
* molecular weight:
+
* centisome position:
−
** 269.277    
+
** 0.18050541    
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine B
 
−
** L-gamma-glutamyl-L-hypoglycin
 
−
** γ-glutamyl-β-(methylenecyclopropyl)-alanine
 
−
** (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-14903]]
−
* [[RXN-9157]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7008]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PROUT-PWY]]
 +
* [[PWY-6922]]
 +
* [[PWY-5737]]
 +
* [[PWY0-1544]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2100}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB29428
+
{{#set: left end position=5}}
−
* Wikipedia : Hypoglycin_B
+
{{#set: centisome position=0.18050541   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-14903|RXN0-7008}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280]
+
{{#set: pathway associated=PROUT-PWY|PWY-6922|PWY-5737|PWY0-1544|CITRULBIO-PWY}}
−
{{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}}
+
−
{{#set: common name=hypoglycin B}}
+
−
{{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}}
+
−
{{#set: molecular weight=269.277   }}
+
−
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}
+
−
{{#set: produced by=RXN-9157}}
+

Latest revision as of 20:24, 21 March 2018

Gene Tiso_gene_18825

  • right end position:
    • 2100
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5
  • centisome position:
    • 0.18050541
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18825&oldid=48505"