Difference between revisions of "2-DEHYDROPANTOATE-REDUCT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * common na...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE-REDUCT-RXN 2-DEHYDROPANTOATE-REDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * commo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE-REDUCT-RXN 2-DEHYDROPANTOATE-REDUCT-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** 2-dehydropantoate_2-reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.169 EC-1.1.1.169] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[2-DEHYDROPANTOATE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[L-PANTOATE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 2-dehydropantoate[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 (R)-pantoate[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12761]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_12762]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_10174]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Gene: [[Tiso_gene_9392]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_16426]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_10173]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PANTO-PWY]], phosphopantothenate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PANTO-PWY PANTO-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6654]], phosphopantothenate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16233 16233] |
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02472 R02472] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CFY8 Q9CFY8] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9V0N0 Q9V0N0] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=2-dehydropantoate_2-reductase}} | |
− | {{#set: | + | {{#set: ec number=EC-1.1.1.169}} |
− | {{#set: common name= | + | {{#set: gene associated=Tiso_gene_12761|Tiso_gene_12762|Tiso_gene_10174|Tiso_gene_9392|Tiso_gene_16426|Tiso_gene_10173}} |
− | {{#set: | + | {{#set: in pathway=PANTO-PWY|PWY-6654}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-synechocystis}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + |
Latest revision as of 21:25, 21 March 2018
Contents
Reaction 2-DEHYDROPANTOATE-REDUCT-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 2-dehydropantoate_2-reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-DEHYDROPANTOATE[c] + 1 NADPH[c] + 1 PROTON[c] => 1 NADP[c] + 1 L-PANTOATE[c]
- With common name(s):
- 1 2-dehydropantoate[c] + 1 NADPH[c] + 1 H+[c] => 1 NADP+[c] + 1 (R)-pantoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12761
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12762
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10174
- Source: orthology-synechocystis
- Gene: Tiso_gene_9392
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16426
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10173
- Source: orthology-synechocystis
Pathways
- PANTO-PWY, phosphopantothenate biosynthesis I: PANTO-PWY
- 4 reactions found over 4 reactions in the full pathway
- PWY-6654, phosphopantothenate biosynthesis III: PWY-6654
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links