Difference between revisions of "PWY-6277"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTHAMIDE DIPHTHAMIDE] == * common name: ** a diphthamide-[translation elongation factor 2] *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTHAMIDE DIPHTHAMIDE] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a diphthamide-[translation elongation factor 2] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** 3- | + | ** a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium |
+ | ** a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl | ||
+ | ** a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine | ||
+ | ** a peptide diphthamide | ||
+ | ** a diphthamide in eEF-2 | ||
+ | ** a [translation elongation factor 2] diphthamide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DIPHTINE--AMMONIA-LIGASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a diphthamide-[translation elongation factor 2]}} | |
− | + | {{#set: common name=a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium|a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl|a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine|a peptide diphthamide|a diphthamide in eEF-2|a [translation elongation factor 2] diphthamide}} | |
− | + | {{#set: produced by=DIPHTINE--AMMONIA-LIGASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=3- | + | |
− | + | ||
− | + | ||
− | {{#set: produced by= | + |
Revision as of 16:33, 10 January 2018
Contents
Metabolite DIPHTHAMIDE
- common name:
- a diphthamide-[translation elongation factor 2]
- Synonym(s):
- a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium
- a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl
- a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine
- a peptide diphthamide
- a diphthamide in eEF-2
- a [translation elongation factor 2] diphthamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a diphthamide-[translation elongation factor 2" cannot be used as a page name in this wiki.
- "a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium" cannot be used as a page name in this wiki.
- "a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl" cannot be used as a page name in this wiki.
- "a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine" cannot be used as a page name in this wiki.
- "a [translation elongation factor 2] diphthamide" cannot be used as a page name in this wiki.