Difference between revisions of "RXN0-5265"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18204 == * left end position: ** 387 * transcription direction: ** NEGATIVE * right end position: ** 3120 * centisome position: ** 12.17747...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Gene Tiso_gene_18204 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 387
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-oxo-(7Z)-tetradecenoyl-CoA
+
** 3120
−
* molecular weight:
+
* centisome position:
−
** 985.829    
+
** 12.17747    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-14:1-Δ7-CoA
 
−
** 3-oxo-7-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17795]]
+
* [[RIBOKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-17794]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-14223]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[RIBOKIN-PWY]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=387}}
−
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
+
{{#set: right end position=3120}}
−
{{#set: molecular weight=985.829   }}
+
{{#set: centisome position=12.17747   }}
−
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
+
{{#set: reaction associated=RIBOKIN-RXN|RXN-14223}}
−
{{#set: consumed by=RXN-17795}}
+
{{#set: pathway associated=RIBOKIN-PWY}}
−
{{#set: produced by=RXN-17794}}
+

Revision as of 15:34, 10 January 2018

Gene Tiso_gene_18204

  • left end position:
    • 387
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3120
  • centisome position:
    • 12.17747
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-5265&oldid=9601"