Difference between revisions of "PHESYN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18719 CPD-18719] == * common name: ** D-fructofuranose 6-phosphate * Synonym(s): == Reacti...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == |
+ | * smiles: | ||
+ | ** C(C1(C(C(C(O1)O)O)O))O | ||
+ | * inchi key: | ||
+ | ** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** α-D-ribofuranose |
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** α D-ribose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RIBOKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-14904]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: common name=D- | + | * PUBCHEM: |
− | {{#set: consumed or produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5575.html 5575] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506] | ||
+ | * HMDB : HMDB00283 | ||
+ | {{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}} | ||
+ | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}} | ||
+ | {{#set: common name=α-D-ribofuranose}} | ||
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: common name=α D-ribose}} | ||
+ | {{#set: consumed by=RIBOKIN-RXN}} | ||
+ | {{#set: consumed or produced by=RXN-14904}} |
Revision as of 16:35, 10 January 2018
Contents
Metabolite CPD-10330
- smiles:
- C(C1(C(C(C(O1)O)O)O))O
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
- common name:
- α-D-ribofuranose
- molecular weight:
- 150.131
- Synonym(s):
- α D-ribose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links