Difference between revisions of "Tiso gene 5387"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] ==
* smiles:
+
* taxonomic range:
** C(CC[N+]CCCCC[N+])[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
 
* common name:
 
* common name:
** aminopropylcadaverine
+
** galactolipid biosynthesis I
* molecular weight:
+
** 162.298   
+
 
* Synonym(s):
 
* Synonym(s):
** N-3-aminopropyl-1,5-diaminopentane
+
** galactosylglyceride biosynthesis I
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
* '''5''' reaction(s) found
* [[RXN0-5217]]
+
** [[2.4.1.46-RXN]]
== Reaction(s) of unknown directionality ==
+
** [[RXN-16635]]
 +
** [[RXN-1226]]
 +
** [[RXN-9721]]
 +
** [[RXN-1225]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-401 PWY-401]
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: common name=galactolipid biosynthesis I}}
* LIGAND-CPD:
+
{{#set: common name=galactosylglyceride biosynthesis I}}
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: reaction found=5}}
* HMDB : HMDB12189
+
{{#set: reaction not found=0}}
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
{{#set: common name=aminopropylcadaverine}}
+
{{#set: molecular weight=162.298    }}
+
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
{{#set: produced by=RXN0-5217}}
+

Revision as of 15:36, 10 January 2018

Pathway PWY-401

  • taxonomic range:
  • common name:
    • galactolipid biosynthesis I
  • Synonym(s):
    • galactosylglyceride biosynthesis I

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links